C22H31NO2Si — CID 178119164
[(3S,4R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]methanol (PubChem CID 178119164) has the molecular formula C22H31NO2Si and a molecular weight of 369.58 g/mol. Its IUPAC name is [(3S,4R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]methanol.
| Compound Name | [(3S,4R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 178119164 |
| Molecular Formula | C22H31NO2Si |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [(3S,4R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]pyrrolidin-3-yl]methanol |
| SMILES | CC(C)(C)[Si](OC[C@H]1CNC[C@H]1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H31NO2Si/c1-22(2,3)26(20-10-6-4-7-11-20,21-12-8-5-9-13-21)25-17-19-15-23-14-18(19)16-24/h4-13,18-19,23-24H,14-17H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | XSYDDDDARJYSBM-RBUKOAKNSA-N |
| XLogP | 2.39 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|