C23H31BrOSi — CID 171429782
[(1R,2R)-2-(bromomethyl)cyclopentyl]methoxy-tert-butyl-diphenylsilane (PubChem CID 171429782) has the molecular formula C23H31BrOSi and a molecular weight of 431.49 g/mol. Its IUPAC name is [(1R,2R)-2-(bromomethyl)cyclopentyl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(1R,2R)-2-(bromomethyl)cyclopentyl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 171429782 |
| Molecular Formula | C23H31BrOSi |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | [(1R,2R)-2-(bromomethyl)cyclopentyl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CCC[C@H]1CBr)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31BrOSi/c1-23(2,3)26(21-13-6-4-7-14-21,22-15-8-5-9-16-22)25-18-20-12-10-11-19(20)17-24/h4-9,13-16,19-20H,10-12,17-18H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | VTROFHGQXWMVGY-PMACEKPBSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|