C27H31BrOSi — CID 67980790
[(1R,2S)-2-(bromomethyl)-2-phenylcyclopropyl]methoxy-tert-butyl-diphenylsilane (PubChem CID 67980790) has the molecular formula C27H31BrOSi and a molecular weight of 479.53 g/mol. Its IUPAC name is [(1R,2S)-2-(bromomethyl)-2-phenylcyclopropyl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(1R,2S)-2-(bromomethyl)-2-phenylcyclopropyl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 67980790 |
| Molecular Formula | C27H31BrOSi |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [(1R,2S)-2-(bromomethyl)-2-phenylcyclopropyl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@]1(CBr)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31BrOSi/c1-26(2,3)30(24-15-9-5-10-16-24,25-17-11-6-12-18-25)29-20-23-19-27(23,21-28)22-13-7-4-8-14-22/h4-18,23H,19-21H2,1-3H3/t23-,27+/m0/s1 |
| InChIKey | JKPLOODRABXORI-WNCULLNHSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|