C22H28ClFO2Si — CID 90339250
tert-butyl-[[(2S,4R,5S)-5-chloro-4-fluoro-4-methyloxolan-2-yl]methoxy]-diphenylsilane (PubChem CID 90339250) has the molecular formula C22H28ClFO2Si and a molecular weight of 407.00 g/mol. Its IUPAC name is tert-butyl-[[(2S,4R,5S)-5-chloro-4-fluoro-4-methyloxolan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,4R,5S)-5-chloro-4-fluoro-4-methyloxolan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 90339250 |
| Molecular Formula | C22H28ClFO2Si |
| Molecular Weight | 407.00 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | tert-butyl-[[(2S,4R,5S)-5-chloro-4-fluoro-4-methyloxolan-2-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@](C)(F)[C@H](Cl)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28ClFO2Si/c1-21(2,3)27(18-11-7-5-8-12-18,19-13-9-6-10-14-19)25-16-17-15-22(4,24)20(23)26-17/h5-14,17,20H,15-16H2,1-4H3/t17-,20+,22+/m0/s1 |
| InChIKey | GWRNBYQMEBZJQB-UCNVEGJOSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.00 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|