C24H31FO4Si — CID 172751639
2-[(2S,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-3-methyloxolan-2-yl]acetic acid (PubChem CID 172751639) has the molecular formula C24H31FO4Si and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-[(2S,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-3-methyloxolan-2-yl]acetic acid.
| Compound Name | 2-[(2S,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-3-methyloxolan-2-yl]acetic acid |
|---|---|
| PubChem CID | 172751639 |
| Molecular Formula | C24H31FO4Si |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-[(2S,3R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluoro-3-methyloxolan-2-yl]acetic acid |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@@](C)(F)[C@H](CC(=O)O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31FO4Si/c1-23(2,3)30(19-11-7-5-8-12-19,20-13-9-6-10-14-20)28-17-18-16-24(4,25)21(29-18)15-22(26)27/h5-14,18,21H,15-17H2,1-4H3,(H,26,27)/t18-,21-,24+/m0/s1 |
| InChIKey | KLLBQQVRSVWZHQ-NSXLHWASSA-N |
| XLogP | 3.92 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|