C21H27FO3Si — CID 101223113
(3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-ol (PubChem CID 101223113) has the molecular formula C21H27FO3Si and a molecular weight of 374.53 g/mol. Its IUPAC name is (3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-ol.
| Compound Name | (3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-ol |
|---|---|
| PubChem CID | 101223113 |
| Molecular Formula | C21H27FO3Si |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (3S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-ol |
| SMILES | CC(C)(C)[Si](OC[C@@H]1C[C@H](F)C(O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H27FO3Si/c1-21(2,3)26(17-10-6-4-7-11-17,18-12-8-5-9-13-18)24-15-16-14-19(22)20(23)25-16/h4-13,16,19-20,23H,14-15H2,1-3H3/t16-,19-,20?/m0/s1 |
| InChIKey | KNNABFCZWIFLEM-QICOWLOGSA-N |
| XLogP | 3.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|