C22H28O4Si — CID 163054050
(4S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxan-2-one (PubChem CID 163054050) has the molecular formula C22H28O4Si and a molecular weight of 384.55 g/mol. Its IUPAC name is (4S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxan-2-one.
| Compound Name | (4S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 163054050 |
| Molecular Formula | C22H28O4Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (4S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxan-2-one |
| SMILES | CC(C)(C)[Si](OCC1C[C@H](O)CC(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O4Si/c1-22(2,3)27(19-10-6-4-7-11-19,20-12-8-5-9-13-20)25-16-18-14-17(23)15-21(24)26-18/h4-13,17-18,23H,14-16H2,1-3H3/t17-,18?/m0/s1 |
| InChIKey | DDGWBTMBQOVSJP-ZENAZSQFSA-N |
| XLogP | 2.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|