C24H24O4Si — CID 162995378
(4S,6S)-4-hydroxy-6-(triphenylsilyloxymethyl)oxan-2-one (PubChem CID 162995378) has the molecular formula C24H24O4Si and a molecular weight of 404.54 g/mol. Its IUPAC name is (4S,6S)-4-hydroxy-6-(triphenylsilyloxymethyl)oxan-2-one.
| Compound Name | (4S,6S)-4-hydroxy-6-(triphenylsilyloxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 162995378 |
| Molecular Formula | C24H24O4Si |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (4S,6S)-4-hydroxy-6-(triphenylsilyloxymethyl)oxan-2-one |
| SMILES | O=C1C[C@@H](O)C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C24H24O4Si/c25-19-16-20(28-24(26)17-19)18-27-29(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15,19-20,25H,16-18H2/t19-,20-/m0/s1 |
| InChIKey | RGQPWBYRWFJZDN-PMACEKPBSA-N |
| XLogP | 1.74 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|