C15H15NO5 — CID 25211441
2-[2-[(2S,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 25211441) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[2-[(2S,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2S,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 25211441 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[2-[(2S,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1C[C@H](O)C[C@H](CCN2C(=O)c3ccccc3C2=O)O1 |
| InChI | InChI=1S/C15H15NO5/c17-9-7-10(21-13(18)8-9)5-6-16-14(19)11-3-1-2-4-12(11)15(16)20/h1-4,9-10,17H,5-8H2/t9-,10+/m1/s1 |
| InChIKey | XMQWKMVXXZHDAV-ZJUUUORDSA-N |
| XLogP | 0.74 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|