C16H17NO4 — CID 58273111
2-[2-[(2S,4S)-4-methyl-6-oxooxan-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 58273111) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-[2-[(2S,4S)-4-methyl-6-oxooxan-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2S,4S)-4-methyl-6-oxooxan-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58273111 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-[2-[(2S,4S)-4-methyl-6-oxooxan-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1CC(=O)O[C@H](CCN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C16H17NO4/c1-10-8-11(21-14(18)9-10)6-7-17-15(19)12-4-2-3-5-13(12)16(17)20/h2-5,10-11H,6-9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | RQENTHJOCRJSCQ-WDEREUQCSA-N |
| XLogP | 2.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|