C16H15NO4 — CID 102215023
2-[3-[(2S)-4-oxo-2,3-dihydropyran-2-yl]propyl]isoindole-1,3-dione (PubChem CID 102215023) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-[3-[(2S)-4-oxo-2,3-dihydropyran-2-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(2S)-4-oxo-2,3-dihydropyran-2-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102215023 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[3-[(2S)-4-oxo-2,3-dihydropyran-2-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1C=CO[C@@H](CCCN2C(=O)c3ccccc3C2=O)C1 |
| InChI | InChI=1S/C16H15NO4/c18-11-7-9-21-12(10-11)4-3-8-17-15(19)13-5-1-2-6-14(13)16(17)20/h1-2,5-7,9,12H,3-4,8,10H2/t12-/m0/s1 |
| InChIKey | MLMHXNMJLHKREC-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|