C15H17NO3 — CID 122459306
2-[3-(3,3-dimethyloxiran-2-yl)propyl]isoindole-1,3-dione (PubChem CID 122459306) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 2-[3-(3,3-dimethyloxiran-2-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(3,3-dimethyloxiran-2-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122459306 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-[3-(3,3-dimethyloxiran-2-yl)propyl]isoindole-1,3-dione |
| SMILES | CC1(C)OC1CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H17NO3/c1-15(2)12(19-15)8-5-9-16-13(17)10-6-3-4-7-11(10)14(16)18/h3-4,6-7,12H,5,8-9H2,1-2H3 |
| InChIKey | HMZXDFDMKHMRJW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|