C14H17NO3 — CID 145335589
4-(1,3-dioxoisoindol-2-yl)butanal;ethane (PubChem CID 145335589) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)butanal;ethane.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)butanal;ethane |
|---|---|
| PubChem CID | 145335589 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)butanal;ethane |
| SMILES | CC.O=CCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H11NO3.C2H6/c14-8-4-3-7-13-11(15)9-5-1-2-6-10(9)12(13)16;1-2/h1-2,5-6,8H,3-4,7H2;1-2H3 |
| InChIKey | MUEINCRNWCBIBI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|