C38H48N2O4 — CID 142691970
2-[22-(1,3-dioxoisoindol-2-yl)docosa-10,12-dienyl]isoindole-1,3-dione (PubChem CID 142691970) has the molecular formula C38H48N2O4 and a molecular weight of 596.81 g/mol. Its IUPAC name is 2-[22-(1,3-dioxoisoindol-2-yl)docosa-10,12-dienyl]isoindole-1,3-dione.
| Compound Name | 2-[22-(1,3-dioxoisoindol-2-yl)docosa-10,12-dienyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142691970 |
| Molecular Formula | C38H48N2O4 |
| Molecular Weight | 596.81 g/mol |
| Exact Mass | 596.36 |
| IUPAC Name | 2-[22-(1,3-dioxoisoindol-2-yl)docosa-10,12-dienyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCCCCC=CC=CCCCCCCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C38H48N2O4/c41-35-31-25-19-20-26-32(31)36(42)39(35)29-23-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-24-30-40-37(43)33-27-21-22-28-34(33)38(40)44/h1-4,19-22,25-28H,5-18,23-24,29-30H2 |
| InChIKey | NOAAWGHCKXHBOV-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.81 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|