C28H26I2N2O4 — CID 159433141
2-[(Z)-6-iodohex-5-enyl]isoindole-1,3-dione;2-(6-iodohex-5-ynyl)isoindole-1,3-dione (PubChem CID 159433141) has the molecular formula C28H26I2N2O4 and a molecular weight of 708.33 g/mol. Its IUPAC name is 2-[(Z)-6-iodohex-5-enyl]isoindole-1,3-dione;2-(6-iodohex-5-ynyl)isoindole-1,3-dione.
| Compound Name | 2-[(Z)-6-iodohex-5-enyl]isoindole-1,3-dione;2-(6-iodohex-5-ynyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 159433141 |
| Molecular Formula | C28H26I2N2O4 |
| Molecular Weight | 708.33 g/mol |
| Exact Mass | 708.00 |
| IUPAC Name | 2-[(Z)-6-iodohex-5-enyl]isoindole-1,3-dione;2-(6-iodohex-5-ynyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCC/C=C\I.O=C1c2ccccc2C(=O)N1CCCCC#CI |
| InChI | InChI=1S/C14H14INO2.C14H12INO2/c2*15-9-5-1-2-6-10-16-13(17)11-7-3-4-8-12(11)14(16)18/h3-5,7-9H,1-2,6,10H2;3-4,7-8H,1-2,6,10H2/b9-5-; |
| InChIKey | LRFVFCPEDNLDTR-UYTGOYFPSA-N |
| XLogP | 6.25 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.33 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|