C17H21NO2 — CID 145234851
ethane;2-hept-5-ynylisoindole-1,3-dione (PubChem CID 145234851) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is ethane;2-hept-5-ynylisoindole-1,3-dione.
| Compound Name | ethane;2-hept-5-ynylisoindole-1,3-dione |
|---|---|
| PubChem CID | 145234851 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | ethane;2-hept-5-ynylisoindole-1,3-dione |
| SMILES | CC.CC#CCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H15NO2.C2H6/c1-2-3-4-5-8-11-16-14(17)12-9-6-7-10-13(12)15(16)18;1-2/h6-7,9-10H,4-5,8,11H2,1H3;1-2H3 |
| InChIKey | NFOYTGSULSEVEC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|