About CID 88976080
CID 88976080 (PubChem CID 88976080) has the molecular formula C14H16BNO2
and a molecular weight of 241.10 g/mol.
Molecular Properties
| Compound Name | CID 88976080 |
| PubChem CID | 88976080 |
| Molecular Formula | C14H16BNO2 |
| Molecular Weight | 241.10 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | — |
| SMILES | [B]CCCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H16BNO2/c15-9-5-1-2-6-10-16-13(17)11-7-3-4-8-12(11)14(16)18/h3-4,7-8H,1-2,5-6,9-10H2 |
| InChIKey | RHXCRLXRPDWIEN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.10 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 88976080 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88976080?
The IUPAC name of CID 88976080 (CID 88976080) is not available.
What is the SMILES notation for CID 88976080?
The canonical SMILES for CID 88976080 is [B]CCCCCCN1C(=O)c2ccccc2C1=O.
What is the InChIKey of CID 88976080?
The InChIKey is RHXCRLXRPDWIEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16BNO2/c15-9-5-1-2-6-10-16-13(17)11-7-3-4-8-12(11)14(16)18/h3-4,7-8H,1-2,5-6,9-10H2.
What are the key properties of CID 88976080?
CID 88976080 has a molecular weight of 241.10 g/mol, XLogP of 2.43, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88976080 is sourced from PubChem (CID 88976080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).