C15H15NO2 — CID 154098229
2-hept-6-ynylisoindole-1,3-dione (PubChem CID 154098229) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-hept-6-ynylisoindole-1,3-dione.
| Compound Name | 2-hept-6-ynylisoindole-1,3-dione |
|---|---|
| PubChem CID | 154098229 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-hept-6-ynylisoindole-1,3-dione |
| SMILES | C#CCCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H15NO2/c1-2-3-4-5-8-11-16-14(17)12-9-6-7-10-13(12)15(16)18/h1,6-7,9-10H,3-5,8,11H2 |
| InChIKey | IBBSWVPKURYOKG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|