C12H10N2O2 — CID 106220357
6-pent-4-ynylpyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 106220357) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 6-pent-4-ynylpyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-pent-4-ynylpyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 106220357 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 6-pent-4-ynylpyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | C#CCCCN1C(=O)c2cccnc2C1=O |
| InChI | InChI=1S/C12H10N2O2/c1-2-3-4-8-14-11(15)9-6-5-7-13-10(9)12(14)16/h1,5-7H,3-4,8H2 |
| InChIKey | AMZGDZIFBBGRKX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|