C15H13N3O3 — CID 61032407
6-[2-(3-aminophenoxy)ethyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 61032407) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 6-[2-(3-aminophenoxy)ethyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[2-(3-aminophenoxy)ethyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 61032407 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 6-[2-(3-aminophenoxy)ethyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | Nc1cccc(OCCN2C(=O)c3cccnc3C2=O)c1 |
| InChI | InChI=1S/C15H13N3O3/c16-10-3-1-4-11(9-10)21-8-7-18-14(19)12-5-2-6-17-13(12)15(18)20/h1-6,9H,7-8,16H2 |
| InChIKey | ZRFDQJRAOFASCB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|