C14H14N4O2 — CID 104734464
5-[2-(3-aminophenoxy)ethyl]pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 104734464) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 5-[2-(3-aminophenoxy)ethyl]pyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 5-[2-(3-aminophenoxy)ethyl]pyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 104734464 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 5-[2-(3-aminophenoxy)ethyl]pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | Nc1cccc(OCCn2ccn3nccc3c2=O)c1 |
| InChI | InChI=1S/C14H14N4O2/c15-11-2-1-3-12(10-11)20-9-8-17-6-7-18-13(14(17)19)4-5-16-18/h1-7,10H,8-9,15H2 |
| InChIKey | IVGYNWRZPJYXRU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|