C10H13N3O2 — CID 104735134
5-(3-hydroxybutyl)pyrazolo[1,5-a]pyrazin-4-one (PubChem CID 104735134) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 5-(3-hydroxybutyl)pyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | 5-(3-hydroxybutyl)pyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 104735134 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 5-(3-hydroxybutyl)pyrazolo[1,5-a]pyrazin-4-one |
| SMILES | CC(O)CCn1ccn2nccc2c1=O |
| InChI | InChI=1S/C10H13N3O2/c1-8(14)3-5-12-6-7-13-9(10(12)15)2-4-11-13/h2,4,6-8,14H,3,5H2,1H3 |
| InChIKey | ISOXLTREWZSUKS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |