C10H12N4O — CID 62677754
3-[2-(1,2,4-triazol-4-yl)ethoxy]aniline (PubChem CID 62677754) has the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. Its IUPAC name is 3-[2-(1,2,4-triazol-4-yl)ethoxy]aniline.
| Compound Name | 3-[2-(1,2,4-triazol-4-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 62677754 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-[2-(1,2,4-triazol-4-yl)ethoxy]aniline |
| SMILES | Nc1cccc(OCCn2cnnc2)c1 |
| InChI | InChI=1S/C10H12N4O/c11-9-2-1-3-10(6-9)15-5-4-14-7-12-13-8-14/h1-3,6-8H,4-5,11H2 |
| InChIKey | DISYMNHIUIVFMF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|