C18H18BrNO3 — CID 91468658
2-[2-(3-bromophenoxy)ethyl]isoindole-1,3-dione;ethane (PubChem CID 91468658) has the molecular formula C18H18BrNO3 and a molecular weight of 376.25 g/mol. Its IUPAC name is 2-[2-(3-bromophenoxy)ethyl]isoindole-1,3-dione;ethane.
| Compound Name | 2-[2-(3-bromophenoxy)ethyl]isoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 91468658 |
| Molecular Formula | C18H18BrNO3 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-[2-(3-bromophenoxy)ethyl]isoindole-1,3-dione;ethane |
| SMILES | CC.O=C1c2ccccc2C(=O)N1CCOc1cccc(Br)c1 |
| InChI | InChI=1S/C16H12BrNO3.C2H6/c17-11-4-3-5-12(10-11)21-9-8-18-15(19)13-6-1-2-7-14(13)16(18)20;1-2/h1-7,10H,8-9H2;1-2H3 |
| InChIKey | YBIDQSJXAZHNDI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|