C19H16BrNO5 — CID 2596880
2-(3-bromophenoxy)ethyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2596880) has the molecular formula C19H16BrNO5 and a molecular weight of 418.24 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | 2-(3-bromophenoxy)ethyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2596880 |
| Molecular Formula | C19H16BrNO5 |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCCOc1cccc(Br)c1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16BrNO5/c1-12(21-17(22)15-7-2-3-8-16(15)18(21)23)19(24)26-10-9-25-14-6-4-5-13(20)11-14/h2-8,11-12H,9-10H2,1H3/t12-/m0/s1 |
| InChIKey | GYAVCPBVBWLLGK-LBPRGKRZSA-N |
| XLogP | 3.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|