C13H10N2O4 — CID 2597534
cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2597534) has the molecular formula C13H10N2O4 and a molecular weight of 258.23 g/mol. Its IUPAC name is cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2597534 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | cyanomethyl (2S)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@@H](C(=O)OCC#N)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H10N2O4/c1-8(13(18)19-7-6-14)15-11(16)9-4-2-3-5-10(9)12(15)17/h2-5,8H,7H2,1H3/t8-/m0/s1 |
| InChIKey | PBWXMWHMVJDQJY-QMMMGPOBSA-N |
| XLogP | 0.74 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|