C14H15NO4S — CID 102250503
2-methylsulfanylethyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 102250503) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-methylsulfanylethyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | 2-methylsulfanylethyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 102250503 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-methylsulfanylethyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CSCCOC(=O)[C@@H](C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H15NO4S/c1-9(14(18)19-7-8-20-2)15-12(16)10-5-3-4-6-11(10)13(15)17/h3-6,9H,7-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | AFRISWCFFLLMSM-SECBINFHSA-N |
| XLogP | 1.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|