C19H16ClNO5 — CID 2596864
2-(2-chlorophenoxy)ethyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 2596864) has the molecular formula C19H16ClNO5 and a molecular weight of 373.79 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)ethyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | 2-(2-chlorophenoxy)ethyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 2596864 |
| Molecular Formula | C19H16ClNO5 |
| Molecular Weight | 373.79 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(2-chlorophenoxy)ethyl (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@H](C(=O)OCCOc1ccccc1Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H16ClNO5/c1-12(21-17(22)13-6-2-3-7-14(13)18(21)23)19(24)26-11-10-25-16-9-5-4-8-15(16)20/h2-9,12H,10-11H2,1H3/t12-/m1/s1 |
| InChIKey | BGVRXHMAKNRYPM-GFCCVEGCSA-N |
| XLogP | 2.95 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|