C19H13Cl2NO5 — CID 1217650
[2-(2,4-dichlorophenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 1217650) has the molecular formula C19H13Cl2NO5 and a molecular weight of 406.22 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 1217650 |
| Molecular Formula | C19H13Cl2NO5 |
| Molecular Weight | 406.22 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] (2R)-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | C[C@H](C(=O)OCC(=O)c1ccc(Cl)cc1Cl)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H13Cl2NO5/c1-10(22-17(24)12-4-2-3-5-13(12)18(22)25)19(26)27-9-16(23)14-7-6-11(20)8-15(14)21/h2-8,10H,9H2,1H3/t10-/m1/s1 |
| InChIKey | LFFZIIIFMGYBOX-SNVBAGLBSA-N |
| XLogP | 3.40 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|