C22H19Cl2NO5 — CID 3428556
[2-(2,4-dichlorophenyl)-2-oxoethyl] 2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)propanoate (PubChem CID 3428556) has the molecular formula C22H19Cl2NO5 and a molecular weight of 448.30 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)propanoate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)propanoate |
|---|---|
| PubChem CID | 3428556 |
| Molecular Formula | C22H19Cl2NO5 |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 2-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)propanoate |
| SMILES | CC(C(=O)OCC(=O)c1ccc(Cl)cc1Cl)N1C(=O)C2C3C=CC(C4CC34)C2C1=O |
| InChI | InChI=1S/C22H19Cl2NO5/c1-9(22(29)30-8-17(26)13-3-2-10(23)6-16(13)24)25-20(27)18-11-4-5-12(15-7-14(11)15)19(18)21(25)28/h2-6,9,11-12,14-15,18-19H,7-8H2,1H3 |
| InChIKey | BJBDAEZKFMEYKA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|