C26H25Cl2NO5 — CID 3828867
[2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)cyclohexane-1-carboxylate (PubChem CID 3828867) has the molecular formula C26H25Cl2NO5 and a molecular weight of 502.39 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)cyclohexane-1-carboxylate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 3828867 |
| Molecular Formula | C26H25Cl2NO5 |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 4-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)cyclohexane-1-carboxylate |
| SMILES | O=C(COC(=O)C1CCC(N2C(=O)C3C4C=CC(C5CC45)C3C2=O)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H25Cl2NO5/c27-13-3-6-17(20(28)9-13)21(30)11-34-26(33)12-1-4-14(5-2-12)29-24(31)22-15-7-8-16(19-10-18(15)19)23(22)25(29)32/h3,6-9,12,14-16,18-19,22-23H,1-2,4-5,10-11H2 |
| InChIKey | MAZUAMJRWIUSAH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|