C24H17Cl2NO4 — CID 124712515
[3-[(1S,2R,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] 2,4-dichlorobenzoate (PubChem CID 124712515) has the molecular formula C24H17Cl2NO4 and a molecular weight of 454.31 g/mol. Its IUPAC name is [3-[(1S,2R,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [3-[(1S,2R,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 124712515 |
| Molecular Formula | C24H17Cl2NO4 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | [3-[(1S,2R,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1cccc(N2C(=O)[C@@H]3[C@H]4C=C[C@@H]([C@@H]5C[C@H]45)[C@H]3C2=O)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H17Cl2NO4/c25-11-4-5-16(19(26)8-11)24(30)31-13-3-1-2-12(9-13)27-22(28)20-14-6-7-15(18-10-17(14)18)21(20)23(27)29/h1-9,14-15,17-18,20-21H,10H2/t14-,15-,17-,18+,20+,21+/m0/s1 |
| InChIKey | AWSNXVFXFIVLKR-FNWGZNAISA-N |
| XLogP | 4.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|