C22H16Br2ClNO4 — CID 124715634
[3-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] 4-chlorobenzoate (PubChem CID 124715634) has the molecular formula C22H16Br2ClNO4 and a molecular weight of 553.63 g/mol. Its IUPAC name is [3-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 124715634 |
| Molecular Formula | C22H16Br2ClNO4 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 550.91 |
| IUPAC Name | [3-[(1R,2S,6R,7R,8S,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(Oc1cccc(N2C(=O)[C@@H]3[C@H]4C[C@@H]([C@H](Br)[C@H]4Br)[C@@H]3C2=O)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16Br2ClNO4/c23-18-14-9-15(19(18)24)17-16(14)20(27)26(21(17)28)12-2-1-3-13(8-12)30-22(29)10-4-6-11(25)7-5-10/h1-8,14-19H,9H2/t14-,15-,16-,17+,18+,19+/m1/s1 |
| InChIKey | PFHQUZJMZCCMFO-VWQYPGANSA-N |
| XLogP | 4.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|