C23H19Br2NO5 — CID 6567218
[3-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] 3-methoxybenzoate (PubChem CID 6567218) has the molecular formula C23H19Br2NO5 and a molecular weight of 549.22 g/mol. Its IUPAC name is [3-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] 3-methoxybenzoate.
| Compound Name | [3-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 6567218 |
| Molecular Formula | C23H19Br2NO5 |
| Molecular Weight | 549.22 g/mol |
| Exact Mass | 546.96 |
| IUPAC Name | [3-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2cccc(N3C(=O)[C@H]4[C@@H]5C[C@@H]([C@@H](Br)[C@H]5Br)[C@@H]4C3=O)c2)c1 |
| InChI | InChI=1S/C23H19Br2NO5/c1-30-13-6-2-4-11(8-13)23(29)31-14-7-3-5-12(9-14)26-21(27)17-15-10-16(18(17)22(26)28)20(25)19(15)24/h2-9,15-20H,10H2,1H3/t15-,16+,17-,18-,19-,20+/m0/s1 |
| InChIKey | CMNKQEALFWYTSZ-DWIKVQACSA-N |
| XLogP | 4.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.22 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|