C24H21Br2NO5 — CID 3254061
[3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl] 2-(4-methoxyphenyl)acetate (PubChem CID 3254061) has the molecular formula C24H21Br2NO5 and a molecular weight of 563.24 g/mol. Its IUPAC name is [3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl] 2-(4-methoxyphenyl)acetate.
| Compound Name | [3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl] 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 3254061 |
| Molecular Formula | C24H21Br2NO5 |
| Molecular Weight | 563.24 g/mol |
| Exact Mass | 560.98 |
| IUPAC Name | [3-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl] 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)Oc2cccc(N3C(=O)C4C5CC(C(Br)C5Br)C4C3=O)c2)cc1 |
| InChI | InChI=1S/C24H21Br2NO5/c1-31-14-7-5-12(6-8-14)9-18(28)32-15-4-2-3-13(10-15)27-23(29)19-16-11-17(20(19)24(27)30)22(26)21(16)25/h2-8,10,16-17,19-22H,9,11H2,1H3 |
| InChIKey | NIGDBIJAGNIUSQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|