C22H25Br2NO4 — CID 99725355
[3-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] heptanoate (PubChem CID 99725355) has the molecular formula C22H25Br2NO4 and a molecular weight of 527.25 g/mol. Its IUPAC name is [3-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] heptanoate.
| Compound Name | [3-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] heptanoate |
|---|---|
| PubChem CID | 99725355 |
| Molecular Formula | C22H25Br2NO4 |
| Molecular Weight | 527.25 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | [3-[(1S,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] heptanoate |
| SMILES | CCCCCCC(=O)Oc1cccc(N2C(=O)[C@H]3[C@@H]4C[C@@H]([C@@H](Br)[C@@H]4Br)[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C22H25Br2NO4/c1-2-3-4-5-9-16(26)29-13-8-6-7-12(10-13)25-21(27)17-14-11-15(18(17)22(25)28)20(24)19(14)23/h6-8,10,14-15,17-20H,2-5,9,11H2,1H3/t14-,15+,17-,18-,19+,20+/m0/s1 |
| InChIKey | SEUJXQZYAGZBCZ-DISKZWMNSA-N |
| XLogP | 4.84 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.25 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|