C25H31Br2NO4 — CID 6566918
[4-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] decanoate (PubChem CID 6566918) has the molecular formula C25H31Br2NO4 and a molecular weight of 569.33 g/mol. Its IUPAC name is [4-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] decanoate.
| Compound Name | [4-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] decanoate |
|---|---|
| PubChem CID | 6566918 |
| Molecular Formula | C25H31Br2NO4 |
| Molecular Weight | 569.33 g/mol |
| Exact Mass | 567.06 |
| IUPAC Name | [4-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] decanoate |
| SMILES | CCCCCCCCCC(=O)Oc1ccc(N2C(=O)[C@H]3[C@@H]4C[C@@H]([C@@H](Br)[C@H]4Br)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C25H31Br2NO4/c1-2-3-4-5-6-7-8-9-19(29)32-16-12-10-15(11-13-16)28-24(30)20-17-14-18(21(20)25(28)31)23(27)22(17)26/h10-13,17-18,20-23H,2-9,14H2,1H3/t17-,18+,20-,21-,22-,23+/m0/s1 |
| InChIKey | PHJRZLMQTWPBTR-SPXUEHIWSA-N |
| XLogP | 6.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.33 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|