C18H23NO4 — CID 3732888
[4-(2,5-dioxopyrrolidin-1-yl)phenyl] octanoate (PubChem CID 3732888) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is [4-(2,5-dioxopyrrolidin-1-yl)phenyl] octanoate.
| Compound Name | [4-(2,5-dioxopyrrolidin-1-yl)phenyl] octanoate |
|---|---|
| PubChem CID | 3732888 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | [4-(2,5-dioxopyrrolidin-1-yl)phenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C18H23NO4/c1-2-3-4-5-6-7-18(22)23-15-10-8-14(9-11-15)19-16(20)12-13-17(19)21/h8-11H,2-7,12-13H2,1H3 |
| InChIKey | LGZYZFSXECDVLS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|