C23H27Br2NO4 — CID 3119391
[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl] octanoate (PubChem CID 3119391) has the molecular formula C23H27Br2NO4 and a molecular weight of 541.28 g/mol. Its IUPAC name is [4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl] octanoate.
| Compound Name | [4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl] octanoate |
|---|---|
| PubChem CID | 3119391 |
| Molecular Formula | C23H27Br2NO4 |
| Molecular Weight | 541.28 g/mol |
| Exact Mass | 539.03 |
| IUPAC Name | [4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1ccc(N2C(=O)C3C4CC(C(Br)C4Br)C3C2=O)cc1 |
| InChI | InChI=1S/C23H27Br2NO4/c1-2-3-4-5-6-7-17(27)30-14-10-8-13(9-11-14)26-22(28)18-15-12-16(19(18)23(26)29)21(25)20(15)24/h8-11,15-16,18-21H,2-7,12H2,1H3 |
| InChIKey | HBXJPCOGFXIIIE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.28 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|