C22H19NO4 — CID 11881592
[3-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] benzoate (PubChem CID 11881592) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is [3-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] benzoate.
| Compound Name | [3-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] benzoate |
|---|---|
| PubChem CID | 11881592 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [3-[(1S,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]phenyl] benzoate |
| SMILES | O=C(Oc1cccc(N2C(=O)[C@@H]3[C@@H]4CC[C@@H](C4)[C@@H]3C2=O)c1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO4/c24-20-18-14-9-10-15(11-14)19(18)21(25)23(20)16-7-4-8-17(12-16)27-22(26)13-5-2-1-3-6-13/h1-8,12,14-15,18-19H,9-11H2/t14-,15+,18-,19+ |
| InChIKey | NHPQSMVZRNXIJT-FDCRZUCXSA-N |
| XLogP | 3.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|