C24H21NO6 — CID 11903739
(4-methoxycarbonylphenyl) 3-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 11903739) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 3-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | (4-methoxycarbonylphenyl) 3-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 11903739 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (4-methoxycarbonylphenyl) 3-[(1S,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(OC(=O)c2cccc(N3C(=O)[C@H]4[C@@H]5CC[C@@H](C5)[C@@H]4C3=O)c2)cc1 |
| InChI | InChI=1S/C24H21NO6/c1-30-23(28)13-7-9-18(10-8-13)31-24(29)16-3-2-4-17(12-16)25-21(26)19-14-5-6-15(11-14)20(19)22(25)27/h2-4,7-10,12,14-15,19-20H,5-6,11H2,1H3/t14-,15+,19-,20-/m0/s1 |
| InChIKey | MQCUUIIDBFEFDI-VZJWBNGJSA-N |
| XLogP | 3.23 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|