C21H17Cl2NO4 — CID 5198646
[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2,4-dichlorobenzoate (PubChem CID 5198646) has the molecular formula C21H17Cl2NO4 and a molecular weight of 418.28 g/mol. Its IUPAC name is [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2,4-dichlorobenzoate.
| Compound Name | [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 5198646 |
| Molecular Formula | C21H17Cl2NO4 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(Oc1cccc(N2C(=O)C3CCCCC3C2=O)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17Cl2NO4/c22-12-8-9-17(18(23)10-12)21(27)28-14-5-3-4-13(11-14)24-19(25)15-6-1-2-7-16(15)20(24)26/h3-5,8-11,15-16H,1-2,6-7H2 |
| InChIKey | CXLYDTOYMNAKQT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|