C22H21NO5 — CID 4641927
[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-methoxybenzoate (PubChem CID 4641927) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-methoxybenzoate.
| Compound Name | [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 4641927 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1cccc(N2C(=O)C3CCCCC3C2=O)c1 |
| InChI | InChI=1S/C22H21NO5/c1-27-19-12-5-4-11-18(19)22(26)28-15-8-6-7-14(13-15)23-20(24)16-9-2-3-10-17(16)21(23)25/h4-8,11-13,16-17H,2-3,9-10H2,1H3 |
| InChIKey | MXOHBYVLFGGLKK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|