C22H21NO4 — CID 2924494
[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-methylbenzoate (PubChem CID 2924494) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-methylbenzoate.
| Compound Name | [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 2924494 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | [3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1cccc(N2C(=O)C3CCCCC3C2=O)c1 |
| InChI | InChI=1S/C22H21NO4/c1-14-7-2-3-10-17(14)22(26)27-16-9-6-8-15(13-16)23-20(24)18-11-4-5-12-19(18)21(23)25/h2-3,6-10,13,18-19H,4-5,11-12H2,1H3 |
| InChIKey | JBBATGJORUZCOA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|