C23H21NO4 — CID 1217779
[3-[(3aR,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] 2-methylbenzoate (PubChem CID 1217779) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is [3-[(3aR,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] 2-methylbenzoate.
| Compound Name | [3-[(3aR,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 1217779 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [3-[(3aR,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] 2-methylbenzoate |
| SMILES | CC1=CC[C@H]2C(=O)N(c3cccc(OC(=O)c4ccccc4C)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C23H21NO4/c1-14-10-11-19-20(12-14)22(26)24(21(19)25)16-7-5-8-17(13-16)28-23(27)18-9-4-3-6-15(18)2/h3-10,13,19-20H,11-12H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | DNGSBIQSIWTNIL-WOJBJXKFSA-N |
| XLogP | 4.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|