C20H17NO4S — CID 27903202
[3-[(3aR,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] thiophene-2-carboxylate (PubChem CID 27903202) has the molecular formula C20H17NO4S and a molecular weight of 367.43 g/mol. Its IUPAC name is [3-[(3aR,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] thiophene-2-carboxylate.
| Compound Name | [3-[(3aR,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 27903202 |
| Molecular Formula | C20H17NO4S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | [3-[(3aR,7aR)-5-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]phenyl] thiophene-2-carboxylate |
| SMILES | CC1=CC[C@H]2C(=O)N(c3cccc(OC(=O)c4cccs4)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C20H17NO4S/c1-12-7-8-15-16(10-12)19(23)21(18(15)22)13-4-2-5-14(11-13)25-20(24)17-6-3-9-26-17/h2-7,9,11,15-16H,8,10H2,1H3/t15-,16-/m1/s1 |
| InChIKey | DZPOPIBGIOUHAJ-HZPDHXFCSA-N |
| XLogP | 3.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|