C20H19NO4S — CID 7279949
[3-[(3aR,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] thiophene-2-carboxylate (PubChem CID 7279949) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is [3-[(3aR,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] thiophene-2-carboxylate.
| Compound Name | [3-[(3aR,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7279949 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [3-[(3aR,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] thiophene-2-carboxylate |
| SMILES | C[C@H]1CC[C@H]2C(=O)N(c3cccc(OC(=O)c4cccs4)c3)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C20H19NO4S/c1-12-7-8-15-16(10-12)19(23)21(18(15)22)13-4-2-5-14(11-13)25-20(24)17-6-3-9-26-17/h2-6,9,11-12,15-16H,7-8,10H2,1H3/t12-,15+,16+/m0/s1 |
| InChIKey | MKLNZEWINHIHFL-APHBMKBZSA-N |
| XLogP | 3.89 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|