C24H18FNO4 — CID 98124834
[3-[(1S,2R,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] 2-fluorobenzoate (PubChem CID 98124834) has the molecular formula C24H18FNO4 and a molecular weight of 403.41 g/mol. Its IUPAC name is [3-[(1S,2R,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] 2-fluorobenzoate.
| Compound Name | [3-[(1S,2R,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 98124834 |
| Molecular Formula | C24H18FNO4 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [3-[(1S,2R,6S,7R,8S,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]phenyl] 2-fluorobenzoate |
| SMILES | O=C(Oc1cccc(N2C(=O)[C@@H]3[C@H]4C=C[C@H]([C@H]5C[C@H]45)[C@@H]3C2=O)c1)c1ccccc1F |
| InChI | InChI=1S/C24H18FNO4/c25-19-7-2-1-6-16(19)24(29)30-13-5-3-4-12(10-13)26-22(27)20-14-8-9-15(18-11-17(14)18)21(20)23(26)28/h1-10,14-15,17-18,20-21H,11H2/t14-,15+,17-,18-,20+,21-/m1/s1 |
| InChIKey | MWQSPSIHKHYIBI-URHBSNRWSA-N |
| XLogP | 3.60 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|