C22H16FNO4 — CID 7381724
[3-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] 2-fluorobenzoate (PubChem CID 7381724) has the molecular formula C22H16FNO4 and a molecular weight of 377.37 g/mol. Its IUPAC name is [3-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] 2-fluorobenzoate.
| Compound Name | [3-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 7381724 |
| Molecular Formula | C22H16FNO4 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [3-[(1S,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl] 2-fluorobenzoate |
| SMILES | O=C(Oc1cccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@H]3C2)c1)c1ccccc1F |
| InChI | InChI=1S/C22H16FNO4/c23-17-7-2-1-6-16(17)22(27)28-15-5-3-4-14(11-15)24-20(25)18-12-8-9-13(10-12)19(18)21(24)26/h1-9,11-13,18-19H,10H2/t12-,13+,18-,19+ |
| InChIKey | LTYVIOCSFVPISY-QXUMQBBKSA-N |
| XLogP | 3.36 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|