C27H29NO6 — CID 124716258
[2-(3-methoxyphenyl)-2-oxoethyl] 4-[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]cyclohexane-1-carboxylate (PubChem CID 124716258) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 4-[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]cyclohexane-1-carboxylate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 4-[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 124716258 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 4-[(1S,2S,6R,7S,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]cyclohexane-1-carboxylate |
| SMILES | COc1cccc(C(=O)COC(=O)C2CCC(N3C(=O)[C@@H]4[C@H]5C=C[C@@H]([C@@H]6C[C@H]56)[C@@H]4C3=O)CC2)c1 |
| InChI | InChI=1S/C27H29NO6/c1-33-17-4-2-3-15(11-17)22(29)13-34-27(32)14-5-7-16(8-6-14)28-25(30)23-18-9-10-19(21-12-20(18)21)24(23)26(28)31/h2-4,9-11,14,16,18-21,23-24H,5-8,12-13H2,1H3/t14?,16?,18-,19-,20-,21+,23-,24+/m0/s1 |
| InChIKey | QZSRJGJJTNWXSN-KZYMCKPBSA-N |
| XLogP | 3.03 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|